C18H20BrNO — CID 102441782
(2R)-N-(2-bromo-4,6-dimethylphenyl)-N-methyl-2-phenylpropanamide (PubChem CID 102441782) has the molecular formula C18H20BrNO and a molecular weight of 346.27 g/mol. Its IUPAC name is (2R)-N-(2-bromo-4,6-dimethylphenyl)-N-methyl-2-phenylpropanamide.
| Compound Name | (2R)-N-(2-bromo-4,6-dimethylphenyl)-N-methyl-2-phenylpropanamide |
|---|---|
| PubChem CID | 102441782 |
| Molecular Formula | C18H20BrNO |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | (2R)-N-(2-bromo-4,6-dimethylphenyl)-N-methyl-2-phenylpropanamide |
| SMILES | Cc1cc(C)c(N(C)C(=O)[C@H](C)c2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C18H20BrNO/c1-12-10-13(2)17(16(19)11-12)20(4)18(21)14(3)15-8-6-5-7-9-15/h5-11,14H,1-4H3/t14-/m1/s1 |
| InChIKey | JAJQQTFWQSOBNO-CQSZACIVSA-N |
| XLogP | 4.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |