C24H30N4O2 — CID 102443107
2-[[2-methoxyethyl(pyridin-2-ylmethyl)amino]methyl]-4-methyl-6-[(pyridin-2-ylmethylamino)methyl]phenol (PubChem CID 102443107) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 2-[[2-methoxyethyl(pyridin-2-ylmethyl)amino]methyl]-4-methyl-6-[(pyridin-2-ylmethylamino)methyl]phenol.
| Compound Name | 2-[[2-methoxyethyl(pyridin-2-ylmethyl)amino]methyl]-4-methyl-6-[(pyridin-2-ylmethylamino)methyl]phenol |
|---|---|
| PubChem CID | 102443107 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 2-[[2-methoxyethyl(pyridin-2-ylmethyl)amino]methyl]-4-methyl-6-[(pyridin-2-ylmethylamino)methyl]phenol |
| SMILES | COCCN(Cc1ccccn1)Cc1cc(C)cc(CNCc2ccccn2)c1O |
| InChI | InChI=1S/C24H30N4O2/c1-19-13-20(15-25-16-22-7-3-5-9-26-22)24(29)21(14-19)17-28(11-12-30-2)18-23-8-4-6-10-27-23/h3-10,13-14,25,29H,11-12,15-18H2,1-2H3 |
| InChIKey | QMAPWVCGUXXKQC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|