C17H20F2N2O — CID 46954040
N-[(2,4-difluorophenyl)methyl]-3-methoxy-N-(pyridin-2-ylmethyl)propan-1-amine (PubChem CID 46954040) has the molecular formula C17H20F2N2O and a molecular weight of 306.36 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-3-methoxy-N-(pyridin-2-ylmethyl)propan-1-amine.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-3-methoxy-N-(pyridin-2-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 46954040 |
| Molecular Formula | C17H20F2N2O |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-3-methoxy-N-(pyridin-2-ylmethyl)propan-1-amine |
| SMILES | COCCCN(Cc1ccccn1)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C17H20F2N2O/c1-22-10-4-9-21(13-16-5-2-3-8-20-16)12-14-6-7-15(18)11-17(14)19/h2-3,5-8,11H,4,9-10,12-13H2,1H3 |
| InChIKey | UTPUBPOHMBUQSK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|