C17H19N2O2+ — CID 102446246
(1,3-dimethylbenzimidazol-3-ium-2-yl)-(4-methoxyphenyl)methanol (PubChem CID 102446246) has the molecular formula C17H19N2O2+ and a molecular weight of 283.35 g/mol. Its IUPAC name is (1,3-dimethylbenzimidazol-3-ium-2-yl)-(4-methoxyphenyl)methanol.
| Compound Name | (1,3-dimethylbenzimidazol-3-ium-2-yl)-(4-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 102446246 |
| Molecular Formula | C17H19N2O2+ |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (1,3-dimethylbenzimidazol-3-ium-2-yl)-(4-methoxyphenyl)methanol |
| SMILES | COc1ccc(C(O)c2n(C)c3ccccc3[n+]2C)cc1 |
| InChI | InChI=1S/C17H19N2O2/c1-18-14-6-4-5-7-15(14)19(2)17(18)16(20)12-8-10-13(21-3)11-9-12/h4-11,16,20H,1-3H3/q+1 |
| InChIKey | JIDOWLKFDSJXKO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|