C16H17N2O+ — CID 755174
2-(4-methoxyphenyl)-1,3-dimethylbenzimidazol-3-ium (PubChem CID 755174) has the molecular formula C16H17N2O+ and a molecular weight of 253.33 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1,3-dimethylbenzimidazol-3-ium.
| Compound Name | 2-(4-methoxyphenyl)-1,3-dimethylbenzimidazol-3-ium |
|---|---|
| PubChem CID | 755174 |
| Molecular Formula | C16H17N2O+ |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-(4-methoxyphenyl)-1,3-dimethylbenzimidazol-3-ium |
| SMILES | COc1ccc(-c2n(C)c3ccccc3[n+]2C)cc1 |
| InChI | InChI=1S/C16H17N2O/c1-17-14-6-4-5-7-15(14)18(2)16(17)12-8-10-13(19-3)11-9-12/h4-11H,1-3H3/q+1 |
| InChIKey | HBTLZTOOBXSQQV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|