C20H22N2O2 — CID 177442093
2-(4-methoxyphenyl)-N,N-dimethyl-2-(1-methylindol-3-yl)acetamide (PubChem CID 177442093) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N,N-dimethyl-2-(1-methylindol-3-yl)acetamide.
| Compound Name | 2-(4-methoxyphenyl)-N,N-dimethyl-2-(1-methylindol-3-yl)acetamide |
|---|---|
| PubChem CID | 177442093 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 2-(4-methoxyphenyl)-N,N-dimethyl-2-(1-methylindol-3-yl)acetamide |
| SMILES | COc1ccc(C(C(=O)N(C)C)c2cn(C)c3ccccc23)cc1 |
| InChI | InChI=1S/C20H22N2O2/c1-21(2)20(23)19(14-9-11-15(24-4)12-10-14)17-13-22(3)18-8-6-5-7-16(17)18/h5-13,19H,1-4H3 |
| InChIKey | ISHVYACJXUEHGN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |