C13H17N2OP — CID 155048137
(2R)-N,N-dimethyl-2-(1-methylindol-3-yl)-2-phosphanylacetamide (PubChem CID 155048137) has the molecular formula C13H17N2OP and a molecular weight of 248.27 g/mol. Its IUPAC name is (2R)-N,N-dimethyl-2-(1-methylindol-3-yl)-2-phosphanylacetamide.
| Compound Name | (2R)-N,N-dimethyl-2-(1-methylindol-3-yl)-2-phosphanylacetamide |
|---|---|
| PubChem CID | 155048137 |
| Molecular Formula | C13H17N2OP |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | (2R)-N,N-dimethyl-2-(1-methylindol-3-yl)-2-phosphanylacetamide |
| SMILES | CN(C)C(=O)[C@H](P)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C13H17N2OP/c1-14(2)13(16)12(17)10-8-15(3)11-7-5-4-6-9(10)11/h4-8,12H,17H2,1-3H3/t12-/m1/s1 |
| InChIKey | VZKYHVMOFNUJLL-GFCCVEGCSA-N |
| XLogP | 2.18 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|