C14H19N3O2 — CID 116911472
2-amino-3-(dimethylamino)-3-(1-methylindol-3-yl)propanoic acid (PubChem CID 116911472) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-amino-3-(dimethylamino)-3-(1-methylindol-3-yl)propanoic acid.
| Compound Name | 2-amino-3-(dimethylamino)-3-(1-methylindol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 116911472 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-amino-3-(dimethylamino)-3-(1-methylindol-3-yl)propanoic acid |
| SMILES | CN(C)C(c1cn(C)c2ccccc12)C(N)C(=O)O |
| InChI | InChI=1S/C14H19N3O2/c1-16(2)13(12(15)14(18)19)10-8-17(3)11-7-5-4-6-9(10)11/h4-8,12-13H,15H2,1-3H3,(H,18,19) |
| InChIKey | YOPVIDSSVZZURH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |