C20H22N4O2 — CID 40938374
(2R)-N,N-dimethyl-2-[2-(1-methylindole-3-carbonyl)hydrazinyl]-2-phenylacetamide (PubChem CID 40938374) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is (2R)-N,N-dimethyl-2-[2-(1-methylindole-3-carbonyl)hydrazinyl]-2-phenylacetamide.
| Compound Name | (2R)-N,N-dimethyl-2-[2-(1-methylindole-3-carbonyl)hydrazinyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 40938374 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (2R)-N,N-dimethyl-2-[2-(1-methylindole-3-carbonyl)hydrazinyl]-2-phenylacetamide |
| SMILES | CN(C)C(=O)[C@H](NNC(=O)c1cn(C)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C20H22N4O2/c1-23(2)20(26)18(14-9-5-4-6-10-14)21-22-19(25)16-13-24(3)17-12-8-7-11-15(16)17/h4-13,18,21H,1-3H3,(H,22,25)/t18-/m1/s1 |
| InChIKey | ZXSNZWXULADVAE-GOSISDBHSA-N |
| XLogP | 2.24 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|