About methyl 5-methoxypenta-2,3-dienoate
methyl 5-methoxypenta-2,3-dienoate (PubChem CID 102446406) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is methyl 5-methoxypenta-2,3-dienoate.
Molecular Properties
| Compound Name | methyl 5-methoxypenta-2,3-dienoate |
| PubChem CID | 102446406 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | methyl 5-methoxypenta-2,3-dienoate |
| SMILES | COCC=C=CC(=O)OC |
| InChI | InChI=1S/C7H10O3/c1-9-6-4-3-5-7(8)10-2/h4-5H,6H2,1-2H3 |
| InChIKey | YQIUQYYICNZGFL-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-methoxypenta-2,3-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-methoxypenta-2,3-dienoate?
The IUPAC name of methyl 5-methoxypenta-2,3-dienoate (CID 102446406) is methyl 5-methoxypenta-2,3-dienoate.
What is the SMILES notation for methyl 5-methoxypenta-2,3-dienoate?
The canonical SMILES for methyl 5-methoxypenta-2,3-dienoate is COCC=C=CC(=O)OC.
What is the InChIKey of methyl 5-methoxypenta-2,3-dienoate?
The InChIKey is YQIUQYYICNZGFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3/c1-9-6-4-3-5-7(8)10-2/h4-5H,6H2,1-2H3.
What are the key properties of methyl 5-methoxypenta-2,3-dienoate?
methyl 5-methoxypenta-2,3-dienoate has a molecular weight of 142.15 g/mol, XLogP of 0.52, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methoxypenta-2,3-dienoate is sourced from PubChem (CID 102446406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).