C15H24O — CID 102446629
(1S,5R,6R,7R)-6-tert-butyltricyclo[5.4.0.01,5]undecan-8-one (PubChem CID 102446629) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (1S,5R,6R,7R)-6-tert-butyltricyclo[5.4.0.01,5]undecan-8-one.
| Compound Name | (1S,5R,6R,7R)-6-tert-butyltricyclo[5.4.0.01,5]undecan-8-one |
|---|---|
| PubChem CID | 102446629 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (1S,5R,6R,7R)-6-tert-butyltricyclo[5.4.0.01,5]undecan-8-one |
| SMILES | CC(C)(C)[C@@H]1[C@H]2CCC[C@]23CCCC(=O)[C@H]13 |
| InChI | InChI=1S/C15H24O/c1-14(2,3)12-10-6-4-8-15(10)9-5-7-11(16)13(12)15/h10,12-13H,4-9H2,1-3H3/t10-,12-,13-,15+/m1/s1 |
| InChIKey | JKSOZQGKXBIVPZ-OPQSFPLASA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |