C14H21IO — CID 10382065
(1R,2R,6S,7R)-1-(iodomethyl)-4,4-dimethyltricyclo[5.4.0.02,6]undecan-8-one (PubChem CID 10382065) has the molecular formula C14H21IO and a molecular weight of 332.23 g/mol. Its IUPAC name is (1R,2R,6S,7R)-1-(iodomethyl)-4,4-dimethyltricyclo[5.4.0.02,6]undecan-8-one.
| Compound Name | (1R,2R,6S,7R)-1-(iodomethyl)-4,4-dimethyltricyclo[5.4.0.02,6]undecan-8-one |
|---|---|
| PubChem CID | 10382065 |
| Molecular Formula | C14H21IO |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | (1R,2R,6S,7R)-1-(iodomethyl)-4,4-dimethyltricyclo[5.4.0.02,6]undecan-8-one |
| SMILES | CC1(C)C[C@H]2[C@@H](C1)[C@]1(CI)CCCC(=O)[C@H]21 |
| InChI | InChI=1S/C14H21IO/c1-13(2)6-9-10(7-13)14(8-15)5-3-4-11(16)12(9)14/h9-10,12H,3-8H2,1-2H3/t9-,10+,12-,14+/m0/s1 |
| InChIKey | XJSRXMQQADPBHQ-HEQLZXTPSA-N |
| XLogP | 3.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|