C15H28 — CID 91731723
(3aR,7aR)-2,2,4,4,7,7-hexamethyl-1,3,3a,5,6,7a-hexahydroindene (PubChem CID 91731723) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is (3aR,7aR)-2,2,4,4,7,7-hexamethyl-1,3,3a,5,6,7a-hexahydroindene.
| Compound Name | (3aR,7aR)-2,2,4,4,7,7-hexamethyl-1,3,3a,5,6,7a-hexahydroindene |
|---|---|
| PubChem CID | 91731723 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | (3aR,7aR)-2,2,4,4,7,7-hexamethyl-1,3,3a,5,6,7a-hexahydroindene |
| SMILES | CC1(C)C[C@@H]2[C@@H](C1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C15H28/c1-13(2)9-11-12(10-13)15(5,6)8-7-14(11,3)4/h11-12H,7-10H2,1-6H3/t11-,12-/m1/s1 |
| InChIKey | RKCBUJRCTQZATH-VXGBXAGGSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |