C6H14N2 — CID 127007229
(3,3-dimethylcyclobutyl)hydrazine (PubChem CID 127007229) has the molecular formula C6H14N2 and a molecular weight of 114.19 g/mol. Its IUPAC name is (3,3-dimethylcyclobutyl)hydrazine.
| Compound Name | (3,3-dimethylcyclobutyl)hydrazine |
|---|---|
| PubChem CID | 127007229 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | (3,3-dimethylcyclobutyl)hydrazine |
| SMILES | CC1(C)CC(NN)C1 |
| InChI | InChI=1S/C6H14N2/c1-6(2)3-5(4-6)8-7/h5,8H,3-4,7H2,1-2H3 |
| InChIKey | BAEMCKRDYVGADL-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|