C15H30N2 — CID 62314944
4-N-(3,3,5-trimethylcyclohexyl)cyclohexane-1,4-diamine (PubChem CID 62314944) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is 4-N-(3,3,5-trimethylcyclohexyl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-(3,3,5-trimethylcyclohexyl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 62314944 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | 4-N-(3,3,5-trimethylcyclohexyl)cyclohexane-1,4-diamine |
| SMILES | CC1CC(NC2CCC(N)CC2)CC(C)(C)C1 |
| InChI | InChI=1S/C15H30N2/c1-11-8-14(10-15(2,3)9-11)17-13-6-4-12(16)5-7-13/h11-14,17H,4-10,16H2,1-3H3 |
| InChIKey | KTOILAAFSGDOMT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |