C16H31NO — CID 114146901
4-[[(3,3,5-trimethylcyclohexyl)amino]methyl]cyclohexan-1-ol (PubChem CID 114146901) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is 4-[[(3,3,5-trimethylcyclohexyl)amino]methyl]cyclohexan-1-ol.
| Compound Name | 4-[[(3,3,5-trimethylcyclohexyl)amino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 114146901 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | 4-[[(3,3,5-trimethylcyclohexyl)amino]methyl]cyclohexan-1-ol |
| SMILES | CC1CC(NCC2CCC(O)CC2)CC(C)(C)C1 |
| InChI | InChI=1S/C16H31NO/c1-12-8-14(10-16(2,3)9-12)17-11-13-4-6-15(18)7-5-13/h12-15,17-18H,4-11H2,1-3H3 |
| InChIKey | AOOYVRCQNWCTQK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |