C14H29NO — CID 8024888
trans-(1S,5R)-N-(3-ethoxypropyl)-3,3,5-trimethylcyclohexan-1-amine (PubChem CID 8024888) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is trans-(1S,5R)-N-(3-ethoxypropyl)-3,3,5-trimethylcyclohexan-1-amine.
| Compound Name | trans-(1S,5R)-N-(3-ethoxypropyl)-3,3,5-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 8024888 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | trans-(1S,5R)-N-(3-ethoxypropyl)-3,3,5-trimethylcyclohexan-1-amine |
| SMILES | CCOCCCN[C@H]1C[C@H](C)CC(C)(C)C1 |
| InChI | InChI=1S/C14H29NO/c1-5-16-8-6-7-15-13-9-12(2)10-14(3,4)11-13/h12-13,15H,5-11H2,1-4H3/t12-,13-/m0/s1 |
| InChIKey | VWPDFPJVRWAPBU-STQMWFEESA-N |
| XLogP | 3.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|