C17H30F3NO4 — CID 166238775
2,2-dimethyl-4-[(3,3,5-trimethylcyclohexyl)amino]butanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 166238775) has the molecular formula C17H30F3NO4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2,2-dimethyl-4-[(3,3,5-trimethylcyclohexyl)amino]butanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2,2-dimethyl-4-[(3,3,5-trimethylcyclohexyl)amino]butanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166238775 |
| Molecular Formula | C17H30F3NO4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 2,2-dimethyl-4-[(3,3,5-trimethylcyclohexyl)amino]butanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC1CC(NCCC(C)(C)C(=O)O)CC(C)(C)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H29NO2.C2HF3O2/c1-11-8-12(10-14(2,3)9-11)16-7-6-15(4,5)13(17)18;3-2(4,5)1(6)7/h11-12,16H,6-10H2,1-5H3,(H,17,18);(H,6,7) |
| InChIKey | VBMCONVQYNTQIX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |