C16H31NO — CID 43081894
N-[3-(cyclopropylmethoxy)propyl]-3,3,5-trimethylcyclohexan-1-amine (PubChem CID 43081894) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is N-[3-(cyclopropylmethoxy)propyl]-3,3,5-trimethylcyclohexan-1-amine.
| Compound Name | N-[3-(cyclopropylmethoxy)propyl]-3,3,5-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 43081894 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | N-[3-(cyclopropylmethoxy)propyl]-3,3,5-trimethylcyclohexan-1-amine |
| SMILES | CC1CC(NCCCOCC2CC2)CC(C)(C)C1 |
| InChI | InChI=1S/C16H31NO/c1-13-9-15(11-16(2,3)10-13)17-7-4-8-18-12-14-5-6-14/h13-15,17H,4-12H2,1-3H3 |
| InChIKey | FLIDLYUVSDWILQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|