C13H25NO2 — CID 115923407
4-[(3,3,5-trimethylcyclohexyl)amino]oxolan-3-ol (PubChem CID 115923407) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 4-[(3,3,5-trimethylcyclohexyl)amino]oxolan-3-ol.
| Compound Name | 4-[(3,3,5-trimethylcyclohexyl)amino]oxolan-3-ol |
|---|---|
| PubChem CID | 115923407 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 4-[(3,3,5-trimethylcyclohexyl)amino]oxolan-3-ol |
| SMILES | CC1CC(NC2COCC2O)CC(C)(C)C1 |
| InChI | InChI=1S/C13H25NO2/c1-9-4-10(6-13(2,3)5-9)14-11-7-16-8-12(11)15/h9-12,14-15H,4-8H2,1-3H3 |
| InChIKey | OYDWVBIQTMIGOY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |