C7H14N2O2 — CID 126846702
(3S,4R)-4-(azetidin-3-ylamino)oxolan-3-ol (PubChem CID 126846702) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is (3S,4R)-4-(azetidin-3-ylamino)oxolan-3-ol.
| Compound Name | (3S,4R)-4-(azetidin-3-ylamino)oxolan-3-ol |
|---|---|
| PubChem CID | 126846702 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | (3S,4R)-4-(azetidin-3-ylamino)oxolan-3-ol |
| SMILES | O[C@@H]1COC[C@H]1NC1CNC1 |
| InChI | InChI=1S/C7H14N2O2/c10-7-4-11-3-6(7)9-5-1-8-2-5/h5-10H,1-4H2/t6-,7-/m1/s1 |
| InChIKey | ATIRLSVAUUSEEU-RNFRBKRXSA-N |
| XLogP | -1.69 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |