C9H16N2O — CID 130678917
(3R,4R)-4-(cyclopent-3-en-1-ylamino)pyrrolidin-3-ol (PubChem CID 130678917) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is (3R,4R)-4-(cyclopent-3-en-1-ylamino)pyrrolidin-3-ol.
| Compound Name | (3R,4R)-4-(cyclopent-3-en-1-ylamino)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 130678917 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | (3R,4R)-4-(cyclopent-3-en-1-ylamino)pyrrolidin-3-ol |
| SMILES | O[C@@H]1CNC[C@H]1NC1CC=CC1 |
| InChI | InChI=1S/C9H16N2O/c12-9-6-10-5-8(9)11-7-3-1-2-4-7/h1-2,7-12H,3-6H2/t8-,9-/m1/s1 |
| InChIKey | APOHGRDNUIWDJG-RKDXNWHRSA-N |
| XLogP | -0.37 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|