C10H20N2O — CID 118392167
1-[(1S,4S)-4-hydrazinyl-2,2-dimethylcyclohexyl]ethanone (PubChem CID 118392167) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 1-[(1S,4S)-4-hydrazinyl-2,2-dimethylcyclohexyl]ethanone.
| Compound Name | 1-[(1S,4S)-4-hydrazinyl-2,2-dimethylcyclohexyl]ethanone |
|---|---|
| PubChem CID | 118392167 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 1-[(1S,4S)-4-hydrazinyl-2,2-dimethylcyclohexyl]ethanone |
| SMILES | CC(=O)[C@H]1CC[C@H](NN)CC1(C)C |
| InChI | InChI=1S/C10H20N2O/c1-7(13)9-5-4-8(12-11)6-10(9,2)3/h8-9,12H,4-6,11H2,1-3H3/t8-,9+/m0/s1 |
| InChIKey | IUYSVOPVOWCGJE-DTWKUNHWSA-N |
| XLogP | 1.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|