C11H23ClN2O2 — CID 118383556
cis-ethyl (1S,4S)-4-hydrazinyl-2,2-dimethylcyclohexane-1-carboxylate;hydrochloride (PubChem CID 118383556) has the molecular formula C11H23ClN2O2 and a molecular weight of 250.77 g/mol. Its IUPAC name is cis-ethyl (1S,4S)-4-hydrazinyl-2,2-dimethylcyclohexane-1-carboxylate;hydrochloride.
| Compound Name | cis-ethyl (1S,4S)-4-hydrazinyl-2,2-dimethylcyclohexane-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 118383556 |
| Molecular Formula | C11H23ClN2O2 |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | cis-ethyl (1S,4S)-4-hydrazinyl-2,2-dimethylcyclohexane-1-carboxylate;hydrochloride |
| SMILES | CCOC(=O)[C@H]1CC[C@H](NN)CC1(C)C.Cl |
| InChI | InChI=1S/C11H22N2O2.ClH/c1-4-15-10(14)9-6-5-8(13-12)7-11(9,2)3;/h8-9,13H,4-7,12H2,1-3H3;1H/t8-,9+;/m0./s1 |
| InChIKey | PCHXSNMASVWYEN-OULXEKPRSA-N |
| XLogP | 1.63 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|