C11H21NS — CID 115021835
N-(3,3-dimethylcyclobutyl)thian-4-amine (PubChem CID 115021835) has the molecular formula C11H21NS and a molecular weight of 199.36 g/mol. Its IUPAC name is N-(3,3-dimethylcyclobutyl)thian-4-amine.
| Compound Name | N-(3,3-dimethylcyclobutyl)thian-4-amine |
|---|---|
| PubChem CID | 115021835 |
| Molecular Formula | C11H21NS |
| Molecular Weight | 199.36 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | N-(3,3-dimethylcyclobutyl)thian-4-amine |
| SMILES | CC1(C)CC(NC2CCSCC2)C1 |
| InChI | InChI=1S/C11H21NS/c1-11(2)7-10(8-11)12-9-3-5-13-6-4-9/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | PQMAAATVJKHXHI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |