C14H24O3 — CID 163009179
1,4,4-trimethyl-9-oxatricyclo[6.3.1.02,6]dodecane-7,8-diol (PubChem CID 163009179) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is 1,4,4-trimethyl-9-oxatricyclo[6.3.1.02,6]dodecane-7,8-diol.
| Compound Name | 1,4,4-trimethyl-9-oxatricyclo[6.3.1.02,6]dodecane-7,8-diol |
|---|---|
| PubChem CID | 163009179 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 1,4,4-trimethyl-9-oxatricyclo[6.3.1.02,6]dodecane-7,8-diol |
| SMILES | CC1(C)CC2C(C1)C1(C)CCOC(O)(C1)C2O |
| InChI | InChI=1S/C14H24O3/c1-12(2)6-9-10(7-12)13(3)4-5-17-14(16,8-13)11(9)15/h9-11,15-16H,4-8H2,1-3H3 |
| InChIKey | OCBOAGNEZBBXFV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |