C15H24O4 — CID 10754379
(1R,2S,3R,7S,8S,9R,10R)-5,5,8-trimethyl-11-oxatetracyclo[7.3.1.01,9.03,7]tridecane-2,8,10-triol (PubChem CID 10754379) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (1R,2S,3R,7S,8S,9R,10R)-5,5,8-trimethyl-11-oxatetracyclo[7.3.1.01,9.03,7]tridecane-2,8,10-triol.
| Compound Name | (1R,2S,3R,7S,8S,9R,10R)-5,5,8-trimethyl-11-oxatetracyclo[7.3.1.01,9.03,7]tridecane-2,8,10-triol |
|---|---|
| PubChem CID | 10754379 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (1R,2S,3R,7S,8S,9R,10R)-5,5,8-trimethyl-11-oxatetracyclo[7.3.1.01,9.03,7]tridecane-2,8,10-triol |
| SMILES | CC1(C)C[C@H]2[C@H](O)[C@@]34CO[C@@H](O)[C@@]3(C4)[C@@](C)(O)[C@H]2C1 |
| InChI | InChI=1S/C15H24O4/c1-12(2)4-8-9(5-12)13(3,18)15-6-14(15,10(8)16)7-19-11(15)17/h8-11,16-18H,4-7H2,1-3H3/t8-,9+,10+,11-,13+,14-,15+/m1/s1 |
| InChIKey | DYBCWJJEJNOFEY-IEVRHGNSSA-N |
| XLogP | 0.89 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |