C15H24O5 — CID 85223180
1,4,4-trimethyl-10-oxatetracyclo[6.4.1.02,6.011,13]tridecane-7,8,11,12-tetrol (PubChem CID 85223180) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is 1,4,4-trimethyl-10-oxatetracyclo[6.4.1.02,6.011,13]tridecane-7,8,11,12-tetrol.
| Compound Name | 1,4,4-trimethyl-10-oxatetracyclo[6.4.1.02,6.011,13]tridecane-7,8,11,12-tetrol |
|---|---|
| PubChem CID | 85223180 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 1,4,4-trimethyl-10-oxatetracyclo[6.4.1.02,6.011,13]tridecane-7,8,11,12-tetrol |
| SMILES | CC1(C)CC2C(O)C3(O)COC4(O)C(O)C(C)(C2C1)C34 |
| InChI | InChI=1S/C15H24O5/c1-12(2)4-7-8(5-12)13(3)10-14(18,9(7)16)6-20-15(10,19)11(13)17/h7-11,16-19H,4-6H2,1-3H3 |
| InChIKey | FCXUXPOAEWAEQN-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |