C15H22O3 — CID 163075025
4,7,7-trimethyl-5,5a,6,8,8a,9-hexahydroazuleno[5,6-c]furan-4,9-diol (PubChem CID 163075025) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 4,7,7-trimethyl-5,5a,6,8,8a,9-hexahydroazuleno[5,6-c]furan-4,9-diol.
| Compound Name | 4,7,7-trimethyl-5,5a,6,8,8a,9-hexahydroazuleno[5,6-c]furan-4,9-diol |
|---|---|
| PubChem CID | 163075025 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 4,7,7-trimethyl-5,5a,6,8,8a,9-hexahydroazuleno[5,6-c]furan-4,9-diol |
| SMILES | CC1(C)CC2CC(C)(O)c3cocc3C(O)C2C1 |
| InChI | InChI=1S/C15H22O3/c1-14(2)4-9-5-15(3,17)12-8-18-7-11(12)13(16)10(9)6-14/h7-10,13,16-17H,4-6H2,1-3H3 |
| InChIKey | DVUNYSPYMVWYHH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |