C16H24O3 — CID 85288716
5-ethoxy-7,7-dimethyl-5,5a,6,8,8a,9-hexahydro-4H-azuleno[5,6-c]furan-9-ol (PubChem CID 85288716) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is 5-ethoxy-7,7-dimethyl-5,5a,6,8,8a,9-hexahydro-4H-azuleno[5,6-c]furan-9-ol.
| Compound Name | 5-ethoxy-7,7-dimethyl-5,5a,6,8,8a,9-hexahydro-4H-azuleno[5,6-c]furan-9-ol |
|---|---|
| PubChem CID | 85288716 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 5-ethoxy-7,7-dimethyl-5,5a,6,8,8a,9-hexahydro-4H-azuleno[5,6-c]furan-9-ol |
| SMILES | CCOC1Cc2cocc2C(O)C2CC(C)(C)CC12 |
| InChI | InChI=1S/C16H24O3/c1-4-19-14-5-10-8-18-9-13(10)15(17)12-7-16(2,3)6-11(12)14/h8-9,11-12,14-15,17H,4-7H2,1-3H3 |
| InChIKey | LKVGLKSHOUPBIP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |