C25H30O4 — CID 122364843
(6S,7R,15S,16R)-5,5,11,11,17,17-hexamethylpentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(19),2,4(8),9,12,14(18)-hexaene-6,7,15,16-tetrol (PubChem CID 122364843) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is (6S,7R,15S,16R)-5,5,11,11,17,17-hexamethylpentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(19),2,4(8),9,12,14(18)-hexaene-6,7,15,16-tetrol.
| Compound Name | (6S,7R,15S,16R)-5,5,11,11,17,17-hexamethylpentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(19),2,4(8),9,12,14(18)-hexaene-6,7,15,16-tetrol |
|---|---|
| PubChem CID | 122364843 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | (6S,7R,15S,16R)-5,5,11,11,17,17-hexamethylpentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(19),2,4(8),9,12,14(18)-hexaene-6,7,15,16-tetrol |
| SMILES | CC1(C)c2cc3c(cc2-c2cc4c(cc21)[C@H](O)[C@H](O)C4(C)C)C(C)(C)[C@H](O)[C@@H]3O |
| InChI | InChI=1S/C25H30O4/c1-23(2)15-9-13-17(24(3,4)21(28)19(13)26)7-11(15)12-8-18-14(10-16(12)23)20(27)22(29)25(18,5)6/h7-10,19-22,26-29H,1-6H3/t19-,20+,21-,22+ |
| InChIKey | AVEOFOMHZBWQKI-COPRSSIGSA-N |
| XLogP | 3.36 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |