C13H22O — CID 91392358
10,10-dimethylbicyclo[7.2.0]undecan-2-one (PubChem CID 91392358) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is 10,10-dimethylbicyclo[7.2.0]undecan-2-one.
| Compound Name | 10,10-dimethylbicyclo[7.2.0]undecan-2-one |
|---|---|
| PubChem CID | 91392358 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 10,10-dimethylbicyclo[7.2.0]undecan-2-one |
| SMILES | CC1(C)CC2C(=O)CCCCCCC21 |
| InChI | InChI=1S/C13H22O/c1-13(2)9-10-11(13)7-5-3-4-6-8-12(10)14/h10-11H,3-9H2,1-2H3 |
| InChIKey | BOCIRCZREQZUQG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |