C21H24F3NO4S — CID 102448903
(2,2,2-trifluoro-1-phenylethyl) 3-(7-methoxy-3,4-dihydro-2H-quinolin-1-yl)propane-1-sulfonate (PubChem CID 102448903) has the molecular formula C21H24F3NO4S and a molecular weight of 443.49 g/mol. Its IUPAC name is (2,2,2-trifluoro-1-phenylethyl) 3-(7-methoxy-3,4-dihydro-2H-quinolin-1-yl)propane-1-sulfonate.
| Compound Name | (2,2,2-trifluoro-1-phenylethyl) 3-(7-methoxy-3,4-dihydro-2H-quinolin-1-yl)propane-1-sulfonate |
|---|---|
| PubChem CID | 102448903 |
| Molecular Formula | C21H24F3NO4S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | (2,2,2-trifluoro-1-phenylethyl) 3-(7-methoxy-3,4-dihydro-2H-quinolin-1-yl)propane-1-sulfonate |
| SMILES | COc1ccc2c(c1)N(CCCS(=O)(=O)OC(c1ccccc1)C(F)(F)F)CCC2 |
| InChI | InChI=1S/C21H24F3NO4S/c1-28-18-11-10-16-9-5-12-25(19(16)15-18)13-6-14-30(26,27)29-20(21(22,23)24)17-7-3-2-4-8-17/h2-4,7-8,10-11,15,20H,5-6,9,12-14H2,1H3 |
| InChIKey | VKNUAKSCEGMZMV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|