C18H31NO4SSi — CID 71527197
3-[7-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-quinolin-1-yl]propane-1-sulfonic acid (PubChem CID 71527197) has the molecular formula C18H31NO4SSi and a molecular weight of 385.60 g/mol. Its IUPAC name is 3-[7-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-quinolin-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[7-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-quinolin-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 71527197 |
| Molecular Formula | C18H31NO4SSi |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 3-[7-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-quinolin-1-yl]propane-1-sulfonic acid |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)N(CCCS(=O)(=O)O)CCC2 |
| InChI | InChI=1S/C18H31NO4SSi/c1-18(2,3)25(4,5)23-16-10-9-15-8-6-11-19(17(15)14-16)12-7-13-24(20,21)22/h9-10,14H,6-8,11-13H2,1-5H3,(H,20,21,22) |
| InChIKey | UOFPLZINKLTDCY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|