C21H24FN3O3 — CID 102449235
[(3R,5R)-5-(3-fluorophenyl)-5-methyl-3-(2-methylpropyl)pyrazolidin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 102449235) has the molecular formula C21H24FN3O3 and a molecular weight of 385.44 g/mol. Its IUPAC name is [(3R,5R)-5-(3-fluorophenyl)-5-methyl-3-(2-methylpropyl)pyrazolidin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [(3R,5R)-5-(3-fluorophenyl)-5-methyl-3-(2-methylpropyl)pyrazolidin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 102449235 |
| Molecular Formula | C21H24FN3O3 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | [(3R,5R)-5-(3-fluorophenyl)-5-methyl-3-(2-methylpropyl)pyrazolidin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | CC(C)C[C@@H]1C[C@](C)(c2cccc(F)c2)N(C(=O)c2ccc([N+](=O)[O-])cc2)N1 |
| InChI | InChI=1S/C21H24FN3O3/c1-14(2)11-18-13-21(3,16-5-4-6-17(22)12-16)24(23-18)20(26)15-7-9-19(10-8-15)25(27)28/h4-10,12,14,18,23H,11,13H2,1-3H3/t18-,21-/m1/s1 |
| InChIKey | SEATYIBVLCZMMT-WIYYLYMNSA-N |
| XLogP | 4.41 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|