C21H33N5O8 — CID 102453533
tert-butyl N-[3-[[(1R)-1-[(3aR,4R,6R,6aR)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-amino-2-oxoethyl]amino]propyl]carbamate (PubChem CID 102453533) has the molecular formula C21H33N5O8 and a molecular weight of 483.52 g/mol. Its IUPAC name is tert-butyl N-[3-[[(1R)-1-[(3aR,4R,6R,6aR)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-amino-2-oxoethyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[(1R)-1-[(3aR,4R,6R,6aR)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-amino-2-oxoethyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 102453533 |
| Molecular Formula | C21H33N5O8 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | tert-butyl N-[3-[[(1R)-1-[(3aR,4R,6R,6aR)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-amino-2-oxoethyl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN[C@@H](C(N)=O)[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C21H33N5O8/c1-20(2,3)34-19(30)24-9-6-8-23-12(16(22)28)13-14-15(33-21(4,5)32-14)17(31-13)26-10-7-11(27)25-18(26)29/h7,10,12-15,17,23H,6,8-9H2,1-5H3,(H2,22,28)(H,24,30)(H,25,27,29)/t12-,13-,14-,15-,17-/m1/s1 |
| InChIKey | AMEWJBRDYDAJOF-DRXUAVOGSA-N |
| XLogP | -0.69 |
| TPSA | 176.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|