C14H7N3O2 — CID 102453647
benzimidazolo[1,2-b][2,6]naphthyridine-5,12-dione (PubChem CID 102453647) has the molecular formula C14H7N3O2 and a molecular weight of 249.23 g/mol. Its IUPAC name is benzimidazolo[1,2-b][2,6]naphthyridine-5,12-dione.
| Compound Name | benzimidazolo[1,2-b][2,6]naphthyridine-5,12-dione |
|---|---|
| PubChem CID | 102453647 |
| Molecular Formula | C14H7N3O2 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | benzimidazolo[1,2-b][2,6]naphthyridine-5,12-dione |
| SMILES | O=C1c2cnccc2C(=O)n2c1nc1ccccc12 |
| InChI | InChI=1S/C14H7N3O2/c18-12-9-7-15-6-5-8(9)14(19)17-11-4-2-1-3-10(11)16-13(12)17/h1-7H |
| InChIKey | GWCXODMSAOFGGU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |