C18H24OS — CID 102453845
1-[5-[(1E,5E,7E)-dodeca-1,5,7-trienyl]thiophen-2-yl]ethanone (PubChem CID 102453845) has the molecular formula C18H24OS and a molecular weight of 288.46 g/mol. Its IUPAC name is 1-[5-[(1E,5E,7E)-dodeca-1,5,7-trienyl]thiophen-2-yl]ethanone.
| Compound Name | 1-[5-[(1E,5E,7E)-dodeca-1,5,7-trienyl]thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 102453845 |
| Molecular Formula | C18H24OS |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 1-[5-[(1E,5E,7E)-dodeca-1,5,7-trienyl]thiophen-2-yl]ethanone |
| SMILES | CCCC/C=C/C=C/CC/C=C/c1ccc(C(C)=O)s1 |
| InChI | InChI=1S/C18H24OS/c1-3-4-5-6-7-8-9-10-11-12-13-17-14-15-18(20-17)16(2)19/h6-9,12-15H,3-5,10-11H2,1-2H3/b7-6+,9-8+,13-12+ |
| InChIKey | CBFGOWVZPSLNIJ-UFVOJDQISA-N |
| XLogP | 6.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|