C23H37NO4S — CID 18372912
ethyl 2-acetamido-3-[5-[(E)-dodec-1-enyl]thiophen-2-yl]-3-hydroxypropanoate (PubChem CID 18372912) has the molecular formula C23H37NO4S and a molecular weight of 423.62 g/mol. Its IUPAC name is ethyl 2-acetamido-3-[5-[(E)-dodec-1-enyl]thiophen-2-yl]-3-hydroxypropanoate.
| Compound Name | ethyl 2-acetamido-3-[5-[(E)-dodec-1-enyl]thiophen-2-yl]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 18372912 |
| Molecular Formula | C23H37NO4S |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | ethyl 2-acetamido-3-[5-[(E)-dodec-1-enyl]thiophen-2-yl]-3-hydroxypropanoate |
| SMILES | CCCCCCCCCC/C=C/c1ccc(C(O)C(NC(C)=O)C(=O)OCC)s1 |
| InChI | InChI=1S/C23H37NO4S/c1-4-6-7-8-9-10-11-12-13-14-15-19-16-17-20(29-19)22(26)21(24-18(3)25)23(27)28-5-2/h14-17,21-22,26H,4-13H2,1-3H3,(H,24,25)/b15-14+ |
| InChIKey | XFMVDFRMPLBUPV-CCEZHUSRSA-N |
| XLogP | 5.39 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|