C24H39NO3 — CID 163111408
N-[3-hydroxy-1-(4-hydroxyphenyl)hexadec-6-en-2-yl]acetamide (PubChem CID 163111408) has the molecular formula C24H39NO3 and a molecular weight of 389.58 g/mol. Its IUPAC name is N-[3-hydroxy-1-(4-hydroxyphenyl)hexadec-6-en-2-yl]acetamide.
| Compound Name | N-[3-hydroxy-1-(4-hydroxyphenyl)hexadec-6-en-2-yl]acetamide |
|---|---|
| PubChem CID | 163111408 |
| Molecular Formula | C24H39NO3 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.29 |
| IUPAC Name | N-[3-hydroxy-1-(4-hydroxyphenyl)hexadec-6-en-2-yl]acetamide |
| SMILES | CCCCCCCCCC=CCCC(O)C(Cc1ccc(O)cc1)NC(C)=O |
| InChI | InChI=1S/C24H39NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-24(28)23(25-20(2)26)19-21-15-17-22(27)18-16-21/h11-12,15-18,23-24,27-28H,3-10,13-14,19H2,1-2H3,(H,25,26) |
| InChIKey | NAOUJBXEYKZIHI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|