C22H32N2O4 — CID 18373028
ethyl 2-acetamido-3-(6-dec-1-ynyl-2-pyridinyl)-3-hydroxypropanoate (PubChem CID 18373028) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is ethyl 2-acetamido-3-(6-dec-1-ynyl-2-pyridinyl)-3-hydroxypropanoate.
| Compound Name | ethyl 2-acetamido-3-(6-dec-1-ynyl-2-pyridinyl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 18373028 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | ethyl 2-acetamido-3-(6-dec-1-ynyl-2-pyridinyl)-3-hydroxypropanoate |
| SMILES | CCCCCCCCC#Cc1cccc(C(O)C(NC(C)=O)C(=O)OCC)n1 |
| InChI | InChI=1S/C22H32N2O4/c1-4-6-7-8-9-10-11-12-14-18-15-13-16-19(24-18)21(26)20(23-17(3)25)22(27)28-5-2/h13,15-16,20-21,26H,4-11H2,1-3H3,(H,23,25) |
| InChIKey | WGZWMJMMPDORBI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|