C22H41NO7 — CID 6439079
(E)-2-acetamido-3,4,5,14-tetrahydroxyicos-6-enoic acid (PubChem CID 6439079) has the molecular formula C22H41NO7 and a molecular weight of 431.57 g/mol. Its IUPAC name is (E)-2-acetamido-3,4,5,14-tetrahydroxyicos-6-enoic acid.
| Compound Name | (E)-2-acetamido-3,4,5,14-tetrahydroxyicos-6-enoic acid |
|---|---|
| PubChem CID | 6439079 |
| Molecular Formula | C22H41NO7 |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | (E)-2-acetamido-3,4,5,14-tetrahydroxyicos-6-enoic acid |
| SMILES | CCCCCCC(O)CCCCCC/C=C/C(O)C(O)C(O)C(NC(C)=O)C(=O)O |
| InChI | InChI=1S/C22H41NO7/c1-3-4-5-10-13-17(25)14-11-8-6-7-9-12-15-18(26)20(27)21(28)19(22(29)30)23-16(2)24/h12,15,17-21,25-28H,3-11,13-14H2,1-2H3,(H,23,24)(H,29,30)/b15-12+ |
| InChIKey | VKFZVQCKAPPEFZ-NTCAYCPXSA-N |
| XLogP | 1.89 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|