C20H39NO6 — CID 6475782
(E,2S,3R,4S,5R)-2-amino-3,4,5,14-tetrahydroxyicos-6-enoic acid (PubChem CID 6475782) has the molecular formula C20H39NO6 and a molecular weight of 389.53 g/mol. Its IUPAC name is (E,2S,3R,4S,5R)-2-amino-3,4,5,14-tetrahydroxyicos-6-enoic acid.
| Compound Name | (E,2S,3R,4S,5R)-2-amino-3,4,5,14-tetrahydroxyicos-6-enoic acid |
|---|---|
| PubChem CID | 6475782 |
| Molecular Formula | C20H39NO6 |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.28 |
| IUPAC Name | (E,2S,3R,4S,5R)-2-amino-3,4,5,14-tetrahydroxyicos-6-enoic acid |
| SMILES | CCCCCCC(O)CCCCCC/C=C/[C@@H](O)[C@H](O)[C@H](O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C20H39NO6/c1-2-3-4-9-12-15(22)13-10-7-5-6-8-11-14-16(23)18(24)19(25)17(21)20(26)27/h11,14-19,22-25H,2-10,12-13,21H2,1H3,(H,26,27)/b14-11+/t15?,16-,17+,18+,19-/m1/s1 |
| InChIKey | UAPFYKYEEDCCTL-IVSDQKRDSA-N |
| XLogP | 1.71 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|