C22H41NO7 — CID 10071415
(E,2S,3R,4S,5S)-5-acetyloxy-2-amino-3,4,14-trihydroxyicos-6-enoic acid (PubChem CID 10071415) has the molecular formula C22H41NO7 and a molecular weight of 431.57 g/mol. Its IUPAC name is (E,2S,3R,4S,5S)-5-acetyloxy-2-amino-3,4,14-trihydroxyicos-6-enoic acid.
| Compound Name | (E,2S,3R,4S,5S)-5-acetyloxy-2-amino-3,4,14-trihydroxyicos-6-enoic acid |
|---|---|
| PubChem CID | 10071415 |
| Molecular Formula | C22H41NO7 |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | (E,2S,3R,4S,5S)-5-acetyloxy-2-amino-3,4,14-trihydroxyicos-6-enoic acid |
| SMILES | CCCCCCC(O)CCCCCC/C=C/[C@H](OC(C)=O)[C@@H](O)[C@H](O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C22H41NO7/c1-3-4-5-10-13-17(25)14-11-8-6-7-9-12-15-18(30-16(2)24)20(26)21(27)19(23)22(28)29/h12,15,17-21,25-27H,3-11,13-14,23H2,1-2H3,(H,28,29)/b15-12+/t17?,18-,19-,20+,21+/m0/s1 |
| InChIKey | PBKBHDLANIOIKK-LNBSYBDWSA-N |
| XLogP | 2.28 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|