C21H41N3O6 — CID 6439076
(E)-2-(diaminomethylideneamino)-3,4,5,14-tetrahydroxyicos-6-enoic acid (PubChem CID 6439076) has the molecular formula C21H41N3O6 and a molecular weight of 431.57 g/mol. Its IUPAC name is (E)-2-(diaminomethylideneamino)-3,4,5,14-tetrahydroxyicos-6-enoic acid.
| Compound Name | (E)-2-(diaminomethylideneamino)-3,4,5,14-tetrahydroxyicos-6-enoic acid |
|---|---|
| PubChem CID | 6439076 |
| Molecular Formula | C21H41N3O6 |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.30 |
| IUPAC Name | (E)-2-(diaminomethylideneamino)-3,4,5,14-tetrahydroxyicos-6-enoic acid |
| SMILES | CCCCCCC(O)CCCCCC/C=C/C(O)C(O)C(O)C(N=C(N)N)C(=O)O |
| InChI | InChI=1S/C21H41N3O6/c1-2-3-4-9-12-15(25)13-10-7-5-6-8-11-14-16(26)18(27)19(28)17(20(29)30)24-21(22)23/h11,14-19,25-28H,2-10,12-13H2,1H3,(H,29,30)(H4,22,23,24)/b14-11+ |
| InChIKey | FFZVMOYYSHXZHW-SDNWHVSQSA-N |
| XLogP | 1.02 |
| TPSA | 182.62 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|