C19H39N3O2 — CID 46832081
2-[(E,2R,3S)-1,3-dihydroxyoctadec-4-en-2-yl]guanidine (PubChem CID 46832081) has the molecular formula C19H39N3O2 and a molecular weight of 341.54 g/mol. Its IUPAC name is 2-[(E,2R,3S)-1,3-dihydroxyoctadec-4-en-2-yl]guanidine.
| Compound Name | 2-[(E,2R,3S)-1,3-dihydroxyoctadec-4-en-2-yl]guanidine |
|---|---|
| PubChem CID | 46832081 |
| Molecular Formula | C19H39N3O2 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.30 |
| IUPAC Name | 2-[(E,2R,3S)-1,3-dihydroxyoctadec-4-en-2-yl]guanidine |
| SMILES | CCCCCCCCCCCCC/C=C/[C@H](O)[C@@H](CO)N=C(N)N |
| InChI | InChI=1S/C19H39N3O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(24)17(16-23)22-19(20)21/h14-15,17-18,23-24H,2-13,16H2,1H3,(H4,20,21,22)/b15-14+/t17-,18+/m1/s1 |
| InChIKey | KZMZOFCREKHNQL-MCXRAWCPSA-N |
| XLogP | 3.24 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|