C7H10O4 — CID 102454118
(4R,5R)-4,5-dihydroxy-3-methoxycyclohex-2-en-1-one (PubChem CID 102454118) has the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. Its IUPAC name is (4R,5R)-4,5-dihydroxy-3-methoxycyclohex-2-en-1-one.
| Compound Name | (4R,5R)-4,5-dihydroxy-3-methoxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 102454118 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | (4R,5R)-4,5-dihydroxy-3-methoxycyclohex-2-en-1-one |
| SMILES | COC1=CC(=O)C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C7H10O4/c1-11-6-3-4(8)2-5(9)7(6)10/h3,5,7,9-10H,2H2,1H3/t5-,7-/m1/s1 |
| InChIKey | RJRRUORUKVHBSR-IYSWYEEDSA-N |
| XLogP | -0.79 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |