C30H25N3O3S2 — CID 102454301
5-[[5-[(2,6-diphenylpyran-4-ylidene)methyl]-1,3-thiazol-2-yl]methylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 102454301) has the molecular formula C30H25N3O3S2 and a molecular weight of 539.68 g/mol. Its IUPAC name is 5-[[5-[(2,6-diphenylpyran-4-ylidene)methyl]-1,3-thiazol-2-yl]methylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[5-[(2,6-diphenylpyran-4-ylidene)methyl]-1,3-thiazol-2-yl]methylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 102454301 |
| Molecular Formula | C30H25N3O3S2 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | 5-[[5-[(2,6-diphenylpyran-4-ylidene)methyl]-1,3-thiazol-2-yl]methylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCN1C(=O)C(=Cc2ncc(C=C3C=C(c4ccccc4)OC(c4ccccc4)=C3)s2)C(=O)N(CC)C1=S |
| InChI | InChI=1S/C30H25N3O3S2/c1-3-32-28(34)24(29(35)33(4-2)30(32)37)18-27-31-19-23(38-27)15-20-16-25(21-11-7-5-8-12-21)36-26(17-20)22-13-9-6-10-14-22/h5-19H,3-4H2,1-2H3 |
| InChIKey | NDWIWLVLVYRDFK-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|