C25H27N3O2S3 — CID 132532762
5-[[5-[4-(diethylamino)phenyl]thieno[3,2-b]thiophen-2-yl]methylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 132532762) has the molecular formula C25H27N3O2S3 and a molecular weight of 497.71 g/mol. Its IUPAC name is 5-[[5-[4-(diethylamino)phenyl]thieno[3,2-b]thiophen-2-yl]methylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[5-[4-(diethylamino)phenyl]thieno[3,2-b]thiophen-2-yl]methylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 132532762 |
| Molecular Formula | C25H27N3O2S3 |
| Molecular Weight | 497.71 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 5-[[5-[4-(diethylamino)phenyl]thieno[3,2-b]thiophen-2-yl]methylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCN1C(=O)C(=Cc2cc3sc(-c4ccc(N(CC)CC)cc4)cc3s2)C(=O)N(CC)C1=S |
| InChI | InChI=1S/C25H27N3O2S3/c1-5-26(6-2)17-11-9-16(10-12-17)20-15-22-21(33-20)14-18(32-22)13-19-23(29)27(7-3)25(31)28(8-4)24(19)30/h9-15H,5-8H2,1-4H3 |
| InChIKey | NKQCIQKQQXYQHF-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.71 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|