C19H22ClN3O — CID 102454423
2-chloro-N-(3,6,6-trimethyl-1-phenyl-5,7-dihydro-4H-indazol-4-yl)prop-2-enamide (PubChem CID 102454423) has the molecular formula C19H22ClN3O and a molecular weight of 343.86 g/mol. Its IUPAC name is 2-chloro-N-(3,6,6-trimethyl-1-phenyl-5,7-dihydro-4H-indazol-4-yl)prop-2-enamide.
| Compound Name | 2-chloro-N-(3,6,6-trimethyl-1-phenyl-5,7-dihydro-4H-indazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 102454423 |
| Molecular Formula | C19H22ClN3O |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-chloro-N-(3,6,6-trimethyl-1-phenyl-5,7-dihydro-4H-indazol-4-yl)prop-2-enamide |
| SMILES | C=C(Cl)C(=O)NC1CC(C)(C)Cc2c1c(C)nn2-c1ccccc1 |
| InChI | InChI=1S/C19H22ClN3O/c1-12(20)18(24)21-15-10-19(3,4)11-16-17(15)13(2)22-23(16)14-8-6-5-7-9-14/h5-9,15H,1,10-11H2,2-4H3,(H,21,24) |
| InChIKey | PPGTWBQPMAJQJN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|